![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - Dehumanized.wv | 2023-10-14 19:41 | 24M | |
| 02 - Baby, What's Your Sign-!.wv | 2023-10-14 19:41 | 20M | |
| 03 - Organized Chaos.wv | 2023-10-14 19:41 | 48M | |
| 04 - I Feel I'm Stoned.wv | 2023-10-14 19:41 | 16M | |
| 05 - Invasion.wv | 2023-10-14 19:41 | 20M | |
| 06 - Fuck the Fascist Control!.wv | 2023-10-14 19:41 | 25M | |
| 07 - Drug Song.wv | 2023-10-14 19:41 | 32M | |
| 08 - Strange Fruit.wv | 2023-10-14 19:41 | 18M | |
| 09 - Godzila in the North.wv | 2023-10-14 19:41 | 34M | |
| 10 - Don't Wanna Be Sedated.wv | 2023-10-14 19:41 | 18M | |
| cover.jpg | 2023-10-14 12:52 | 43K | |
