![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - X-T-C.wv | 2022-08-10 20:46 | 31M | |
| 02 - Generation Clash.wv | 2022-08-10 20:46 | 44M | |
| 03 - Chain Reaction.wv | 2022-08-10 20:46 | 34M | |
| 04 - Love Sensation.wv | 2022-08-10 20:46 | 33M | |
| 05 - Turn the Wheel.wv | 2022-08-10 20:46 | 36M | |
| 06 - Hellhammer.wv | 2022-08-10 20:46 | 39M | |
| 07 - Prisoner.wv | 2022-08-10 20:46 | 31M | |
| 08 - I can't Believe in You.wv | 2022-08-10 20:46 | 34M | |
| 09 - Mistreated.wv | 2022-08-10 20:46 | 60M | |
| 10 - Stand 4 What U R.wv | 2022-08-10 20:46 | 30M | |
| 11 - Break the Ice.wv | 2022-08-10 20:46 | 31M | |
| 12 - D-Train.wv | 2022-08-10 20:46 | 32M | |
| cover.jpg | 2022-08-10 18:36 | 248K | |
