![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| cover.jpg | 2024-04-22 22:11 | 102K | |
| 1 - Inpropagation.wv | 2024-04-22 22:43 | 46M | |
| 2 - Corporal Jigsore Quandary.wv | 2024-04-22 22:43 | 38M | |
| 3 - Symposium of Sickness.wv | 2024-04-22 22:43 | 46M | |
| 4 - Pedigree Butchery.wv | 2024-04-22 22:43 | 34M | |
| 5 - Incarnated Solvent Abuse.wv | 2024-04-22 22:43 | 32M | |
| 6 - Carneous Cacoffiny.wv | 2024-04-22 22:43 | 44M | |
| 7 - Lavaging Expectorate of Lysergide Composition.wv | 2024-04-22 22:43 | 27M | |
| 8 - Forensic Clinicism The Sanguine Article.wv | 2024-04-22 22:43 | 46M | |