![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| cover.jpg | 2022-07-31 16:30 | 132K | |
| 08 - Kristallen den fina.wv | 2022-08-01 00:18 | 17M | |
| 09 - The Healing Smoke.wv | 2022-08-01 00:18 | 37M | |
| 12 - Remembering.wv | 2022-08-01 00:18 | 29M | |
| 14 - Mieli miehelle.wv | 2022-08-01 00:18 | 22M | |
| 15 - The Survivor.wv | 2022-08-01 00:18 | 20M | |
| 01 - Norwegian Mountains.wv | 2022-08-01 00:18 | 18M | |
| 02 - Gaia.wv | 2022-08-01 00:18 | 22M | |
| 03 - Länsiranta.wv | 2022-08-01 00:18 | 21M | |
| 04 - The Waves of Life.wv | 2022-08-01 00:18 | 23M | |
| 05 - Lemmen käki.wv | 2022-08-01 00:18 | 21M | |
| 06 - Biegga.wv | 2022-08-01 00:18 | 24M | |
| 07 - Norwegian Mood.wv | 2022-08-01 00:18 | 26M | |
| 10 - En etsi valtaa, loistoa.wv | 2022-08-01 00:18 | 15M | |
| 11 - Enchanted Place.wv | 2022-08-01 00:18 | 15M | |
| 13 - Napoleon.wv | 2022-08-01 00:18 | 20M | |
| 16 - Slingerdanish.wv | 2022-08-01 00:18 | 16M | |
| 17 - The Door is Open.wv | 2022-08-01 00:18 | 30M | |