![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - Flesh Storm.wv | 2023-11-14 13:36 | 31M | |
| 02 - Catalyst.wv | 2023-11-14 13:36 | 23M | |
| 03 - Skeleton Christ.wv | 2023-11-14 13:36 | 33M | |
| 04 - Eyes of the Insane.wv | 2023-11-14 13:36 | 25M | |
| 05 - Jihad.wv | 2023-11-14 13:36 | 26M | |
| 06 - Consfearacy.wv | 2023-11-14 13:36 | 24M | |
| 07 - Catatonic.wv | 2023-11-14 13:36 | 37M | |
| 08 - Black Serenade.wv | 2023-11-14 13:36 | 25M | |
| 09 - Cult.wv | 2023-11-14 13:36 | 33M | |
| 10 - Supremist.wv | 2023-11-14 13:36 | 29M | |
| cover.jpg | 2023-11-14 13:02 | 112K | |
